| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30086012 | HIV | ENSG00000188778.6 | protein_coding | ADRB3 | No | No | 155 | A8KAG8 P13945 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ADRB3 |
|---|---|
| DrugBank ID | DB14895 |
| Drug Name | Vibegron |
| Target ID | BE0001012 |
| UniProt ID | P13945 |
| Regulation Type | agonist |
| PubMed IDs | 32993398 |
| Citations | Rechberger T, Wrobel A: Evaluating vibegron for the treatment of overactive bladder. Expert Opin Pharmacother. 2020 Sep 29:1-9. doi: 10.1080/14656566.2020.1809652. |
| Groups | Approved; Investigational |
| Direct Classification | |
| SMILES | [H][C@@]1(CC[C@@H](CC2=CC=C(NC(=O)[C@@H]3CCC4=NC=CC(=O)N34)C=C2)N1)[C@H](O)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL2107826 |
