| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30086012 | HIV | ENSG00000188778.6 | protein_coding | ADRB3 | No | No | 155 | A8KAG8 P13945 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ADRB3 |
|---|---|
| DrugBank ID | DB01288 |
| Drug Name | Fenoterol |
| Target ID | BE0001012 |
| UniProt ID | P13945 |
| Regulation Type | agonist |
| PubMed IDs | 14730417 |
| Citations | Hoffmann C, Leitz MR, Oberdorf-Maass S, Lohse MJ, Klotz KN: Comparative pharmacology of human beta-adrenergic receptor subtypes--characterization of stably transfected receptors in CHO cells. Naunyn Schmiedebergs Arch Pharmacol. 2004 Feb;369(2):151-9. Epub 2004 Jan 17. |
| Groups | Approved; Investigational |
| Direct Classification | Amphetamines and derivatives |
| SMILES | CC(CC1=CC=C(O)C=C1)NCC(O)C1=CC(O)=CC(O)=C1 |
| Pathways | |
| PharmGKB | PA10079 |
| ChEMBL | CHEMBL32800 |