| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30086012 | HIV | ENSG00000188778.6 | protein_coding | ADRB3 | No | No | 155 | A8KAG8 P13945 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ADRB3 |
|---|---|
| DrugBank ID | DB01407 |
| Drug Name | Clenbuterol |
| Target ID | BE0001012 |
| UniProt ID | P13945 |
| Regulation Type | agonist |
| PubMed IDs | 20590599 |
| Citations | Baker JG: The selectivity of beta-adrenoceptor agonists at human beta1-, beta2- and beta3-adrenoceptors. Br J Pharmacol. 2010 Jul;160(5):1048-61. doi: 10.1111/j.1476-5381.2010.00754.x. |
| Groups | Approved; Investigational; Vet_approved |
| Direct Classification | Dichlorobenzenes |
| SMILES | CC(C)(C)NCC(O)C1=CC(Cl)=C(N)C(Cl)=C1 |
| Pathways | |
| PharmGKB | PA164745640 |
| ChEMBL | CHEMBL49080 |
