| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10019035 | HBV | ENSG00000198848.13 | protein_coding | CES1 | No | No | 1066 | P23141 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CES1 |
|---|---|
| DrugBank ID | DB04838 |
| Drug Name | Cyclandelate |
| Target ID | BE0002705 |
| UniProt ID | P23141 |
| Regulation Type | |
| PubMed IDs | 2306268 |
| Citations | Heffron F, Middleton B, White DA: Inhibition of acyl coenzyme A: cholesterol acyl transferase by trimethylcyclohexanylmandelate (cyclandelate). Biochem Pharmacol. 1990 Feb 1;39(3):575-80. |
| Groups | Approved |
| Direct Classification | Benzene and substituted derivatives |
| SMILES | CC1CC(CC(C)(C)C1)OC(=O)C(O)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | PA164748026 |
| ChEMBL | CHEMBL1480987 |
