| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10019035 | HBV | ENSG00000198848.13 | protein_coding | CES1 | No | No | 1066 | P23141 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CES1 |
|---|---|
| DrugBank ID | DB01183 |
| Drug Name | Naloxone |
| Target ID | BE0002705 |
| UniProt ID | P23141 |
| Regulation Type | binder |
| PubMed IDs | 12679808 |
| Citations | Bencharit S, Morton CL, Xue Y, Potter PM, Redinbo MR: Structural basis of heroin and cocaine metabolism by a promiscuous human drug-processing enzyme. Nat Struct Biol. 2003 May;10(5):349-56. |
| Groups | Approved; Vet_approved |
| Direct Classification | Phenanthrenes and derivatives |
| SMILES | OC1=CC=C2C[C@H]3N(CC=C)CC[C@@]45[C@@H](OC1=C24)C(=O)CC[C@@]35O |
| Pathways | Naloxone Action Pathway |
| PharmGKB | PA450586 |
| ChEMBL | CHEMBL80 |
