| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10019035 | HBV | ENSG00000198848.13 | protein_coding | CES1 | No | No | 1066 | P23141 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CES1 |
|---|---|
| DrugBank ID | DB00907 |
| Drug Name | Cocaine |
| Target ID | BE0002705 |
| UniProt ID | P23141 |
| Regulation Type | binder |
| PubMed IDs | 9311626 |
| Citations | Brzezinski MR, Spink BJ, Dean RA, Berkman CE, Cashman JR, Bosron WF: Human liver carboxylesterase hCE-1: binding specificity for cocaine, heroin, and their metabolites and analogs. Drug Metab Dispos. 1997 Sep;25(9):1089-96. |
| Groups | Approved; Illicit |
| Direct Classification | Benzoic acid esters |
| SMILES | [H][C@]12CC[C@]([H])([C@H]([C@H](C1)OC(=O)C1=CC=CC=C1)C(=O)OC)N2C |
| Pathways | Cocaine Action Pathway |
| PharmGKB | PA449072 |
| ChEMBL | CHEMBL370805 |
