| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10019035 | HBV | ENSG00000198848.13 | protein_coding | CES1 | No | No | 1066 | P23141 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CES1 |
|---|---|
| DrugBank ID | DB00454 |
| Drug Name | Meperidine |
| Target ID | BE0002705 |
| UniProt ID | P23141 |
| Regulation Type | |
| PubMed IDs | 10381793 |
| Citations | Zhang J, Burnell JC, Dumaual N, Bosron WF: Binding and hydrolysis of meperidine by human liver carboxylesterase hCE-1. J Pharmacol Exp Ther. 1999 Jul;290(1):314-8. |
| Groups | Approved |
| Direct Classification | Phenylpiperidines |
| SMILES | CCOC(=O)C1(CCN(C)CC1)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | PA450369 |
| ChEMBL | CHEMBL607 |
