| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44035147 | HTLV-1 | ENSG00000189221.11 | protein_coding | MAOA | No | No | 4128 | P21397 Q49A63 Q53YE7 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MAOA |
|---|---|
| DrugBank ID | DB01171 |
| Drug Name | Moclobemide |
| Target ID | BE0004909 |
| UniProt ID | P27338 |
| Regulation Type | antagonist |
| PubMed IDs | 12595913 |
| Citations | Bonnet U: Moclobemide: therapeutic use and clinical studies. CNS Drug Rev. 2003 Spring;9(1):97-140. doi: 10.1111/j.1527-3458.2003.tb00245.x. |
| Groups | Approved; Investigational |
| Direct Classification | 4-halobenzoic acids and derivatives |
| SMILES | ClC1=CC=C(C=C1)C(=O)NCCN1CCOCC1 |
| Pathways | |
| PharmGKB | PA452615 |
| ChEMBL | CHEMBL86304 |
