| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44035147 | HTLV-1 | ENSG00000189221.11 | protein_coding | MAOA | No | No | 4128 | P21397 Q49A63 Q53YE7 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MAOA |
|---|---|
| DrugBank ID | DB00805 |
| Drug Name | Minaprine |
| Target ID | BE0002198 |
| UniProt ID | P21397 |
| Regulation Type | inhibitor |
| PubMed IDs | 3954800 |
| Citations | Kan JP, Mouget-Goniot C, Worms P, Biziere K: Effect of the antidepressant minaprine on both forms of monoamine oxidase in the rat. Biochem Pharmacol. 1986 Mar 15;35(6):973-8. |
| Groups | Approved |
| Direct Classification | Phenylpyridazines |
| SMILES | CC1=CC(=NN=C1NCCN1CCOCC1)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | PA164748351 |
| ChEMBL | CHEMBL278819 |
