| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44035147 | HTLV-1 | ENSG00000189221.11 | protein_coding | MAOA | No | No | 4128 | P21397 Q49A63 Q53YE7 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MAOA |
|---|---|
| DrugBank ID | DB13876 |
| Drug Name | Brofaromine |
| Target ID | BE0002198 |
| UniProt ID | P21397 |
| Regulation Type | inhibitor |
| PubMed IDs | 10063483 |
| Citations | Lotufo-Neto F, Trivedi M, Thase ME: Meta-analysis of the reversible inhibitors of monoamine oxidase type A moclobemide and brofaromine for the treatment of depression. Neuropsychopharmacology. 1999 Mar;20(3):226-47. |
| Groups | Experimental |
| Direct Classification | Benzofurans |
| SMILES | COC1=CC2=C(OC(=C2)C2CCNCC2)C(Br)=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL160347 |
