| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44035147 | HTLV-1 | ENSG00000189221.11 | protein_coding | MAOA | No | No | 4128 | P21397 Q49A63 Q53YE7 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MAOA |
|---|---|
| DrugBank ID | DB04821 |
| Drug Name | Nomifensine |
| Target ID | BE0002198 |
| UniProt ID | P21397 |
| Regulation Type | |
| PubMed IDs | 10580379 |
| Citations | Egashira T, Takayama F, Yamanaka Y: The inhibition of monoamine oxidase activity by various antidepressants: differences found in various mammalian species. Jpn J Pharmacol. 1999 Sep;81(1):115-21. |
| Groups | Approved; Withdrawn |
| Direct Classification | 4-phenyltetrahydroisoquinolines |
| SMILES | CN1CC(C2=CC=CC=C2)C2=C(C1)C(N)=CC=C2 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL273575 |
