| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10032762 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS10059189 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30014568 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30077154 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30024844 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS20068134 | HPV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS44007688 | HTLV-1 | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS43000129 | MCV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ATP1A1 |
|---|---|
| DrugBank ID | DB01430 |
| Drug Name | Almitrine |
| Target ID | BE0000732 |
| UniProt ID | P05023 |
| Regulation Type | binder |
| PubMed IDs | 2144185; 2165421; 2527061; 8099718; 11752352 |
| Citations | Rigoulet M: Control processes in oxidative phosphorylation: kinetic constraints and stoichiometry. Biochim Biophys Acta. 1990 Jul 25;1018(2-3):185-9.@@Rigoulet M, Fraisse L, Ouhabi R, Guerin B, Fontaine E, Leverve X: Flux-dependent increase in the stoichiometry of charge translocation by mitochondrial ATPase/ATP synthase induced by almitrine. Biochim Biophys Acta. 1990 Jul 17;1018(1):91-7.@@Rigoulet M, Ouhabi R, Leverve X, Putod-Paramelle F, Guerin B: Almitrine, a new kind of energy-transduction inhibitor acting on mitochondrial ATP synthase. Biochim Biophys Acta. 1989 Aug 3;975(3):325-9.@@Benzi G, Gorini A, Ghigini B, Arnaboldi R, Villa RF: Synaptosomal non-mitochondrial ATPase activities and drug treatment. Neurochem Res. 1993 Jun;18(6):719-26.@@Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5. |
| Groups | Approved |
| Direct Classification | Diphenylmethanes |
| SMILES | FC1=CC=C(C=C1)C(N1CCN(CC1)C1=NC(NCC=C)=NC(NCC=C)=N1)C1=CC=C(F)C=C1 |
| Pathways | |
| PharmGKB | PA164750492 |
| ChEMBL | CHEMBL1183717 |
