| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10032762 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS10059189 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30014568 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30077154 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30024844 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS20068134 | HPV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS44007688 | HTLV-1 | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS43000129 | MCV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ATP1A1 |
|---|---|
| DrugBank ID | DB00511 |
| Drug Name | Acetyldigitoxin |
| Target ID | BE0000732 |
| UniProt ID | P05023 |
| Regulation Type | inhibitor |
| PubMed IDs | 2826993 |
| Citations | Gonzalez-Garcia C, Cena V, Klein DC: Characterization of the alpha +-like Na+,K+-ATPase which mediates ouabain inhibition of adrenergic induction of N-acetyltransferase (EC 2.3.1.87) activity: studies with isolated pinealocytes. Mol Pharmacol. 1987 Dec;32(6):792-7. |
| Groups | Approved |
| Direct Classification | Cardenolide glycosides and derivatives |
| SMILES | [H][C@@]1(CC[C@]2(O)[C@]3([H])CC[C@]4([H])C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)O[C@H]1C[C@H](O)[C@H](O[C@H]2C[C@H](O)[C@H](O[C@H]3C[C@H](OC(C)=O)[C@H](O)[C@@H](C)O3)[C@@H](C)O2)[C@@H](C)O1)C1=CC(=O)OC1 |
| Pathways | |
| PharmGKB | PA164746246 |
| ChEMBL | CHEMBL3545057 |
