| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10032762 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS10059189 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30014568 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30077154 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30024844 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS20068134 | HPV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS44007688 | HTLV-1 | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS43000129 | MCV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ATP1A1 |
|---|---|
| DrugBank ID | DB09020 |
| Drug Name | Bisacodyl |
| Target ID | BE0010055 |
| UniProt ID | P54710 |
| Regulation Type | inhibitor |
| PubMed IDs | 6253843 |
| Citations | Schreiner J, Nell G, Loeschke K: Effect of diphenolic laxatives on Na+-K+-activated ATPase and cyclic nucleotide content of rat colon mucosa in vivo. Naunyn Schmiedebergs Arch Pharmacol. 1980 Sep;313(3):249-55. doi: 10.1007/BF00505741. |
| Groups | Approved |
| Direct Classification | Diphenylmethanes |
| SMILES | CC(=O)OC1=CC=C(C=C1)C(C1=CC=C(OC(C)=O)C=C1)C1=CC=CC=N1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL942 |
