| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10032762 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS10059189 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30014568 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30077154 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30024844 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS20068134 | HPV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS44007688 | HTLV-1 | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS43000129 | MCV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ATP1A1 |
|---|---|
| DrugBank ID | DB14515 |
| Drug Name | Magnesium lactate |
| Target ID | BE0000732 |
| UniProt ID | P05023 |
| Regulation Type | |
| PubMed IDs | 16808357; 16928192; 16990961; 17294093 |
| Citations | Buchachenko AL, Kuznetsov DA, Berdinskii VL: [New mechanisms of biological effects of electromagnetic fields]. Biofizika. 2006 May-Jun;51(3):545-52.@@Sirijovski N, Olsson U, Lundqvist J, Al-Karadaghi S, Willows RD, Hansson M: ATPase activity associated with the magnesium chelatase H-subunit of the chlorophyll biosynthetic pathway is an artefact. Biochem J. 2006 Dec 15;400(3):477-84.@@Balasubramaniyan V, Nalini N: Leptin alters brain adenosine triphosphatase activity in ethanol-mediated neurotoxicity in mice. Singapore Med J. 2006 Oct;47(10):864-8.@@Nogovitsina OR, Levitina EV: Neurological aspects of the clinical features, pathophysiology, and corrections of impairments in attention deficit hyperactivity disorder. Neurosci Behav Physiol. 2007 Mar;37(3):199-202. |
| Groups | Nutraceutical |
| Direct Classification | |
| SMILES | [Mg++].CC(O)C([O-])=O.CC(O)C([O-])=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL3707281 |