| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10032762 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS10059189 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30014568 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30077154 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30024844 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS20068134 | HPV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS44007688 | HTLV-1 | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS43000129 | MCV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ATP1A1 |
|---|---|
| DrugBank ID | DB01158 |
| Drug Name | Bretylium |
| Target ID | BE0000732 |
| UniProt ID | P05023 |
| Regulation Type | inhibitor |
| PubMed IDs | 1334399; 15121098; 1662173; 1667290 |
| Citations | Dzimiri N, Almotrefi AA: Inhibition of myocardial Na(+)-K(+)-ATPase activity by bretylium: role of potassium. Arch Int Pharmacodyn Ther. 1992 Jul-Aug;318:76-85.@@Helms JB, Arnett KL, Gatto C, Milanick MA: Bretylium, an organic quaternary amine, inhibits the Na,K-ATPase by binding to the extracellular K-site. Blood Cells Mol Dis. 2004 May-Jun;32(3):394-400.@@Dzimiri N, Almotrefi AA: Interaction of bretylium tosylate with guinea-pig myocardial Na(+)-K(+)-ATPase. Gen Pharmacol. 1991;22(5):935-8.@@Tiku PE, Nowell PT: Selective inhibition of K(+)-stimulation of Na,K-ATPase by bretylium. Br J Pharmacol. 1991 Dec;104(4):895-900. |
| Groups | Approved |
| Direct Classification | Phenylmethylamines |
| SMILES | CC[N+](C)(C)CC1=CC=CC=C1Br |
| Pathways | |
| PharmGKB | PA448662 |
| ChEMBL | CHEMBL1199080 |
