| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10032762 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS10059189 | HBV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30014568 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30077154 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS30024844 | HIV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS20068134 | HPV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS44007688 | HTLV-1 | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
| TVIS43000129 | MCV | ENSG00000163399.16 | protein_coding | ATP1A1 | Yes | Yes | 476 | P05023 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ATP1A1 |
|---|---|
| DrugBank ID | DB00903 |
| Drug Name | Etacrynic acid |
| Target ID | BE0000732 |
| UniProt ID | P05023 |
| Regulation Type | inhibitor |
| PubMed IDs | 124205; 124600; 12680902; 12713517; 127690 |
| Citations | Ronquist G, Agren GK: A Mg2+- and Ca2+-stimulated adenosine triphosphatase at the outer surface of Ehrlich ascites tumor cells. Cancer Res. 1975 Jun;35(6):1402-6.@@Proverbio F, Condrescu-Guidi M, Whittembury G: Ouabain-insensitive Na+ stimulation of an Mg-2+ -dependent ATPase in kidney tissue. Biochim Biophys Acta. 1975 Jun 25;394(2):281-92.@@Valdes RM, Huff MO, El-Masri MA, El-Mallakh RS: Effect of ethacrynic acid on sodium pump alpha isoforms in SH-SY5Y cells. Bipolar Disord. 2003 Apr;5(2):123-8.@@Kiil F, Sejersted OM: Analysis of energy metabolism and mechanism of loop diuretics in the thick ascending limb of Henle's loop in dog kidneys. Acta Physiol Scand. 2003 May;178(1):73-82.@@Schurek HJ, Aulbert E, Ebel H, Muller-Suur C: Influence of ouabain and ethacrynic acid on sodium transport and NaK-ATPase activity in the isolated perfused rat kidney. Curr Probl Clin Biochem. 1975;4:162-8. |
| Groups | Approved; Investigational |
| Direct Classification | Chlorophenoxyacetates |
| SMILES | CCC(=C)C(=O)C1=C(Cl)C(Cl)=C(OCC(O)=O)C=C1 |
| Pathways | Ethacrynic Acid Action Pathway |
| PharmGKB | PA449518 |
| ChEMBL | CHEMBL456 |
