| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10039668 | HBV | ENSG00000055118.18 | protein_coding | KCNH2 | No | No | 3757 | A0A090N7W1 A0A090N7X5 A0A090N8Q0 Q12809 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KCNH2 |
|---|---|
| DrugBank ID | DB06207 |
| Drug Name | Silodosin |
| Target ID | BE0009629 |
| UniProt ID | Q9NS40 |
| Regulation Type | blocker |
| PubMed IDs | 17225563 |
| Citations | Tatemichi S, Kiguchi S, Kobayashi M, Yamazaki Y, Shibata N, Uruno T: Cardiovascular effects of the selective alphalA-adrenoceptor antagonist silodosin (KMD-3213), a drug for the treatment of voiding dysfunction. Arzneimittelforschung. 2006;56(10):682-7. doi: 10.1055/s-0031-1296773. |
| Groups | Approved |
| Direct Classification | Indolecarboxamides and derivatives |
| SMILES | C[C@H](CC1=CC2=C(N(CCCO)CC2)C(=C1)C(N)=O)NCCOC1=CC=CC=C1OCC(F)(F)F |
| Pathways | |
| PharmGKB | PA165291889 |
| ChEMBL | CHEMBL24778 |