| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10039668 | HBV | ENSG00000055118.18 | protein_coding | KCNH2 | No | No | 3757 | A0A090N7W1 A0A090N7X5 A0A090N8Q0 Q12809 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KCNH2 |
|---|---|
| DrugBank ID | DB06217 |
| Drug Name | Vernakalant |
| Target ID | BE0000090 |
| UniProt ID | Q12809 |
| Regulation Type | blocker |
| PubMed IDs | |
| Citations | Dia E.Q., Rathbun R.A., Song J.C.: Vernakalant: A novel antiarrhythmic agent for the treatment of atrial fibrillation Formulary. 2007 August 1;42:475-483. |
| Groups | Approved; Investigational |
| Direct Classification | Tyrosols and derivatives |
| SMILES | COC1=C(OC)C=C(CCO[C@@H]2CCCC[C@H]2N2CC[C@@H](O)C2)C=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL2111112 |
