| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10039668 | HBV | ENSG00000055118.18 | protein_coding | KCNH2 | No | No | 3757 | A0A090N7W1 A0A090N7X5 A0A090N8Q0 Q12809 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KCNH2 |
|---|---|
| DrugBank ID | DB06457 |
| Drug Name | Tecastemizole |
| Target ID | BE0000090 |
| UniProt ID | Q12809 |
| Regulation Type | |
| PubMed IDs | 10376921 |
| Citations | Zhou Z, Vorperian VR, Gong Q, Zhang S, January CT: Block of HERG potassium channels by the antihistamine astemizole and its metabolites desmethylastemizole and norastemizole. J Cardiovasc Electrophysiol. 1999 Jun;10(6):836-43. |
| Groups | Investigational |
| Direct Classification | Benzimidazoles |
| SMILES | FC1=CC=C(CN2C(NC3CCNCC3)=NC3=CC=CC=C23)C=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL61301 |
