| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10039668 | HBV | ENSG00000055118.18 | protein_coding | KCNH2 | No | No | 3757 | A0A090N7W1 A0A090N7X5 A0A090N8Q0 Q12809 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KCNH2 |
|---|---|
| DrugBank ID | DB11186 |
| Drug Name | Pentoxyverine |
| Target ID | BE0000090 |
| UniProt ID | Q12809 |
| Regulation Type | inhibitor |
| PubMed IDs | 19034038 |
| Citations | Deisemann H, Ahrens N, Schlobohm I, Kirchhoff C, Netzer R, Moller C: Effects of common antitussive drugs on the hERG potassium channel current. J Cardiovasc Pharmacol. 2008 Dec;52(6):494-9. doi: 10.1097/FJC.0b013e31818eec8d. |
| Groups | Approved; Investigational; Withdrawn |
| Direct Classification | Benzene and substituted derivatives |
| SMILES | CCN(CC)CCOCCOC(=O)C1(CCCC1)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL73234 |
