| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44045428 | HTLV-1 | ENSG00000091831.25 | protein_coding | ESR1 | Yes | No | 2099 | A0A125SXW3 G4XH65 H0Y4W6 P03372 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ESR1 |
|---|---|
| DrugBank ID | DB12450 |
| Drug Name | Propyl Gallate |
| Target ID | BE0000123 |
| UniProt ID | P03372 |
| Regulation Type | |
| PubMed IDs | 19063592 |
| Citations | Amadasi A, Mozzarelli A, Meda C, Maggi A, Cozzini P: Identification of xenoestrogens in food additives by an integrated in silico and in vitro approach. Chem Res Toxicol. 2009 Jan;22(1):52-63. doi: 10.1021/tx800048m. |
| Groups | Investigational |
| Direct Classification | Galloyl esters |
| SMILES | CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL7983 |