| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44045428 | HTLV-1 | ENSG00000091831.25 | protein_coding | ESR1 | Yes | No | 2099 | A0A125SXW3 G4XH65 H0Y4W6 P03372 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ESR1 |
|---|---|
| DrugBank ID | DB01183 |
| Drug Name | Naloxone |
| Target ID | BE0000123 |
| UniProt ID | P03372 |
| Regulation Type | antagonist |
| PubMed IDs | 16546975 |
| Citations | Farooqui M, Geng ZH, Stephenson EJ, Zaveri N, Yee D, Gupta K: Naloxone acts as an antagonist of estrogen receptor activity in MCF-7 cells. Mol Cancer Ther. 2006 Mar;5(3):611-20. |
| Groups | Approved; Vet_approved |
| Direct Classification | Phenanthrenes and derivatives |
| SMILES | OC1=CC=C2C[C@H]3N(CC=C)CC[C@@]45[C@@H](OC1=C24)C(=O)CC[C@@]35O |
| Pathways | Naloxone Action Pathway |
| PharmGKB | PA450586 |
| ChEMBL | CHEMBL80 |