| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44045428 | HTLV-1 | ENSG00000091831.25 | protein_coding | ESR1 | Yes | No | 2099 | A0A125SXW3 G4XH65 H0Y4W6 P03372 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ESR1 |
|---|---|
| DrugBank ID | DB00269 |
| Drug Name | Chlorotrianisene |
| Target ID | BE0000123 |
| UniProt ID | P03372 |
| Regulation Type | agonist |
| PubMed IDs | 2307235; 6872937; 17236558; 11752352 |
| Citations | Kupfer D, Bulger WH: Inactivation of the uterine estrogen receptor binding of estradiol during P-450 catalyzed metabolism of chlorotrianisene (TACE). Speculation that TACE antiestrogenic activity involves covalent binding to the estrogen receptor. FEBS Lett. 1990 Feb 12;261(1):59-62.@@Jordan VC, Gosden B: Inhibition of the uterotropic activity of estrogens and antiestrogens by the short acting antiestrogen LY117018. Endocrinology. 1983 Aug;113(2):463-8.@@Wang JY, Xu BH, Tian LJ, Wang Y: [Clinical characteristics and potential prognostic factors of breast cancer patients with liver metastases]. Zhonghua Zhong Liu Za Zhi. 2006 Aug;28(8):612-6.@@Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5. |
| Groups | Investigational; Withdrawn |
| Direct Classification | Stilbenes |
| SMILES | COC1=CC=C(C=C1)C(Cl)=C(C1=CC=C(OC)C=C1)C1=CC=C(OC)C=C1 |
| Pathways | |
| PharmGKB | PA164768822 |
| ChEMBL | CHEMBL1200761 |
