| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44045428 | HTLV-1 | ENSG00000091831.25 | protein_coding | ESR1 | Yes | No | 2099 | A0A125SXW3 G4XH65 H0Y4W6 P03372 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ESR1 |
|---|---|
| DrugBank ID | DB09070 |
| Drug Name | Tibolone |
| Target ID | BE0000123 |
| UniProt ID | P03372 |
| Regulation Type | antagonist |
| PubMed IDs | 19464167 |
| Citations | Escande A, Servant N, Rabenoelina F, Auzou G, Kloosterboer H, Cavailles V, Balaguer P, Maudelonde T: Regulation of activities of steroid hormone receptors by tibolone and its primary metabolites. J Steroid Biochem Mol Biol. 2009 Aug;116(1-2):8-14. doi: 10.1016/j.jsbmb.2009.03.008. Epub 2009 Apr 2. |
| Groups | Approved; Investigational |
| Direct Classification | Oxosteroids |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(C)CC[C@]1([H])C3=C(CC(=O)CC3)C[C@@]([H])(C)[C@@]21[H] |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL2103774 |
