| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44045428 | HTLV-1 | ENSG00000091831.25 | protein_coding | ESR1 | Yes | No | 2099 | A0A125SXW3 G4XH65 H0Y4W6 P03372 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ESR1 |
|---|---|
| DrugBank ID | DB13943 |
| Drug Name | Testosterone cypionate |
| Target ID | BE0000123 |
| UniProt ID | P03372 |
| Regulation Type | |
| PubMed IDs | 12676605 |
| Citations | Kojima H, Iida M, Katsura E, Kanetoshi A, Hori Y, Kobayashi K: Effects of a diphenyl ether-type herbicide, chlornitrofen, and its amino derivative on androgen and estrogen receptor activities. Environ Health Perspect. 2003 Apr;111(4):497-502. |
| Groups | Approved |
| Direct Classification | Steroid esters |
| SMILES | [H][C@@]12CC[C@H](OC(=O)CCC3CCCC3)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1201101 |