| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44047170 | HTLV-1 | ENSG00000140009.19 | protein_coding | ESR2 | No | No | 2100 | Q92731 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ESR2 |
|---|---|
| DrugBank ID | DB03467 |
| Drug Name | Naringenin |
| Target ID | BE0000792 |
| UniProt ID | Q92731 |
| Regulation Type | partial agonist |
| PubMed IDs | 9751507 |
| Citations | Kuiper GG, Lemmen JG, Carlsson B, Corton JC, Safe SH, van der Saag PT, van der Burg B, Gustafsson JA: Interaction of estrogenic chemicals and phytoestrogens with estrogen receptor beta. Endocrinology. 1998 Oct;139(10):4252-63. |
| Groups | Experimental |
| Direct Classification | Flavanones |
| SMILES | [H][C@]1(CC(=O)C2=C(O1)C=C(O)C=C2O)C1=CC=C(O)C=C1 |
| Pathways | |
| PharmGKB | PA151958361 |
| ChEMBL | CHEMBL9352 |