| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44047170 | HTLV-1 | ENSG00000140009.19 | protein_coding | ESR2 | No | No | 2100 | Q92731 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ESR2 |
|---|---|
| DrugBank ID | DB06202 |
| Drug Name | Lasofoxifene |
| Target ID | BE0000792 |
| UniProt ID | Q92731 |
| Regulation Type | agonist |
| PubMed IDs | 19519291 |
| Citations | Peng J, Sengupta S, Jordan VC: Potential of selective estrogen receptor modulators as treatments and preventives of breast cancer. Anticancer Agents Med Chem. 2009 Jun;9(5):481-99. |
| Groups | Approved; Investigational |
| Direct Classification | Phenylnaphthalenes |
| SMILES | [H][C@@]1(CCC2=CC(O)=CC=C2[C@@]1([H])C1=CC=C(OCCN2CCCC2)C=C1)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL328190 |
