| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44047170 | HTLV-1 | ENSG00000140009.19 | protein_coding | ESR2 | No | No | 2100 | Q92731 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ESR2 |
|---|---|
| DrugBank ID | DB04020 |
| Drug Name | 4-(2-{[4-{[3-(4-Chlorophenyl)Propyl]Sulfanyl}-6-(1-Piperazinyl)-1,3,5-Triazin-2-Yl]Amino}Ethyl)Phenol |
| Target ID | BE0000792 |
| UniProt ID | Q92731 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | N-arylpiperazines |
| SMILES | OC1=CC=C(CCNC2=NC(SCCCC3=CC=C(Cl)C=C3)=NC(=N2)N2CCNCC2)C=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL346455 |