| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44010428 | HTLV-1 | ENSG00000166736.12 | protein_coding | HTR3A | No | No | 3359 | P46098 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HTR3A |
|---|---|
| DrugBank ID | DB01221 |
| Drug Name | Ketamine |
| Target ID | BE0000311 |
| UniProt ID | P46098 |
| Regulation Type | potentiator |
| PubMed IDs | 8777109 |
| Citations | Appadu BL, Lambert DG: Interaction of i.v. anaesthetic agents with 5-HT3 receptors. Br J Anaesth. 1996 Feb;76(2):271-3. |
| Groups | Approved; Vet_approved |
| Direct Classification | Chlorobenzenes |
| SMILES | CNC1(CCCCC1=O)C1=CC=CC=C1Cl |
| Pathways | |
| PharmGKB | PA450144 |
| ChEMBL | CHEMBL742 |
