| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44010428 | HTLV-1 | ENSG00000166736.12 | protein_coding | HTR3A | No | No | 3359 | P46098 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HTR3A |
|---|---|
| DrugBank ID | DB04885 |
| Drug Name | Cilansetron |
| Target ID | BE0000311 |
| UniProt ID | P46098 |
| Regulation Type | |
| PubMed IDs | 15757394; 16898618 |
| Citations | Chey WD, Cash BD: Cilansetron: a new serotonergic agent for the irritable bowel syndrome with diarrhoea. Expert Opin Investig Drugs. 2005 Feb;14(2):185-93.@@Komoto S, Miura S: [Antagonists of the type 3 serotonin receptor (5 -HT3) in IBS]. Nihon Rinsho. 2006 Aug;64(8):1487-90. |
| Groups | Investigational |
| Direct Classification | Carbazoles |
| SMILES | CC1=NC=CN1C[C@H]1CCC2=C(C3=CC=CC4=C3N2CCC4)C1=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL2103778 |
