| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44010428 | HTLV-1 | ENSG00000166736.12 | protein_coding | HTR3A | No | No | 3359 | P46098 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HTR3A |
|---|---|
| DrugBank ID | DB00555 |
| Drug Name | Lamotrigine |
| Target ID | BE0000311 |
| UniProt ID | P46098 |
| Regulation Type | inhibitor |
| PubMed IDs | 26339247 |
| Citations | Kotwal A, Cutrona SL: Serotonin Syndrome in the Setting of Lamotrigine, Aripiprazole, and Cocaine Use. Case Rep Med. 2015;2015:769531. doi: 10.1155/2015/769531. Epub 2015 Aug 2. |
| Groups | Approved; Investigational |
| Direct Classification | Dichlorobenzenes |
| SMILES | NC1=NC(N)=C(N=N1)C1=C(Cl)C(Cl)=CC=C1 |
| Pathways | |
| PharmGKB | PA450164 |
| ChEMBL | CHEMBL741 |
