| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44010428 | HTLV-1 | ENSG00000166736.12 | protein_coding | HTR3A | No | No | 3359 | P46098 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HTR3A |
|---|---|
| DrugBank ID | DB00721 |
| Drug Name | Procaine |
| Target ID | BE0000311 |
| UniProt ID | P46098 |
| Regulation Type | antagonist |
| PubMed IDs | 7539114; 11752352 |
| Citations | Fan P, Weight FF: Procaine impairs the function of 5-HT3 receptor-ion channel complex in rat sensory ganglion neurons. Neuropharmacology. 1994 Dec;33(12):1573-9.@@Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5. |
| Groups | Approved; Investigational; Vet_approved |
| Direct Classification | Benzoic acid esters |
| SMILES | CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 |
| Pathways | Procaine Action Pathway |
| PharmGKB | PA451110 |
| ChEMBL | CHEMBL569 |
