| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10039668 | HBV | ENSG00000055118.18 | protein_coding | KCNH2 | No | No | 3757 | A0A090N7W1 A0A090N7X5 A0A090N8Q0 Q12809 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KCNH2 |
|---|---|
| DrugBank ID | DB01211 |
| Drug Name | Clarithromycin |
| Target ID | BE0000090 |
| UniProt ID | Q12809 |
| Regulation Type | |
| PubMed IDs | 12873512 |
| Citations | Keseru GM: Prediction of hERG potassium channel affinity by traditional and hologram qSAR methods. Bioorg Med Chem Lett. 2003 Aug 18;13(16):2773-5. |
| Groups | Approved |
| Direct Classification | Aminoglycosides |
| SMILES | [H][C@@]1(C[C@@](C)(OC)[C@@H](O)[C@H](C)O1)O[C@H]1[C@H](C)[C@@H](O[C@]2([H])O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@@](C)(C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@H]1C)OC |
| Pathways | Clarithromycin Action Pathway |
| PharmGKB | PA449028 |
| ChEMBL | CHEMBL1741 |
