| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20030137 | HPV | ENSG00000103546.19 | protein_coding | SLC6A2 | No | No | 6530 | P23975 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SLC6A2 |
|---|---|
| DrugBank ID | DB00514 |
| Drug Name | Dextromethorphan |
| Target ID | BE0000486 |
| UniProt ID | P23975 |
| Regulation Type | inhibitor |
| PubMed IDs | 7562497 |
| Citations | Codd EE, Shank RP, Schupsky JJ, Raffa RB: Serotonin and norepinephrine uptake inhibiting activity of centrally acting analgesics: structural determinants and role in antinociception. J Pharmacol Exp Ther. 1995 Sep;274(3):1263-70. |
| Groups | Approved |
| Direct Classification | Morphinans |
| SMILES | [H][C@]12CCCC[C@]11CCN(C)[C@H]2CC2=C1C=C(OC)C=C2 |
| Pathways | |
| PharmGKB | PA449273 |
| ChEMBL | CHEMBL52440 |
