| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20030137 | HPV | ENSG00000103546.19 | protein_coding | SLC6A2 | No | No | 6530 | P23975 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SLC6A2 |
|---|---|
| DrugBank ID | DB01173 |
| Drug Name | Orphenadrine |
| Target ID | BE0000486 |
| UniProt ID | P23975 |
| Regulation Type | inhibitor |
| PubMed IDs | 10344632 |
| Citations | Pubill D, Canudas AM, Pallas M, Sureda FX, Escubedo E, Camins A, Camarasa J: Assessment of the adrenergic effects of orphenadrine in rat vas deferens. J Pharm Pharmacol. 1999 Mar;51(3):307-12. |
| Groups | Approved |
| Direct Classification | Diphenylmethanes |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C1=CC=CC=C1C |
| Pathways | Orphenadrine H1-Antihistamine Action |
| PharmGKB | PA450715 |
| ChEMBL | CHEMBL900 |
