| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20030137 | HPV | ENSG00000103546.19 | protein_coding | SLC6A2 | No | No | 6530 | P23975 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SLC6A2 |
|---|---|
| DrugBank ID | DB01442 |
| Drug Name | MMDA |
| Target ID | BE0000486 |
| UniProt ID | P23975 |
| Regulation Type | negative modulator |
| PubMed IDs | 17209801 |
| Citations | Fleckenstein AE, Volz TJ, Riddle EL, Gibb JW, Hanson GR: New insights into the mechanism of action of amphetamines. Annu Rev Pharmacol Toxicol. 2007;47:681-98. |
| Groups | Experimental; Illicit |
| Direct Classification | Benzodioxoles |
| SMILES | COC1=CC(CC(C)N)=CC2=C1OCO2 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL126506 |
