Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1C |
|---|---|
| DrugBank ID | DB00568 |
| Drug Name | Cinnarizine |
| Target ID | BE0000430 |
| UniProt ID | Q13936 |
| Regulation Type | inhibitor |
| PubMed IDs | 3530295; 1281221 |
| Citations | Singh BN: The mechanism of action of calcium antagonists relative to their clinical applications. Br J Clin Pharmacol. 1986;21 Suppl 2:109S-121S.@@Cohen CJ, Spires S, Van Skiver D: Block of T-type Ca channels in guinea pig atrial cells by antiarrhythmic agents and Ca channel antagonists. J Gen Physiol. 1992 Oct;100(4):703-28. |
| Groups | Approved; Investigational |
| Direct Classification | |
| SMILES | C(C=CC1=CC=CC=C1)N1CCN(CC1)C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Pathways | Cinnarizine H1-Antihistamine Action |
| PharmGKB | PA164749342 |
| ChEMBL | CHEMBL43064 |
