Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1C |
|---|---|
| DrugBank ID | DB09238 |
| Drug Name | Manidipine |
| Target ID | BE0008715 |
| UniProt ID | O00555 |
| Regulation Type | blocker |
| PubMed IDs | 15329044 |
| Citations | McKeage K, Scott LJ: Manidipine: a review of its use in the management of hypertension. Drugs. 2004;64(17):1923-40. |
| Groups | Approved; Investigational |
| Direct Classification | Diphenylmethanes |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C1C1=CC(=CC=C1)N(=O)=O)C(=O)OCCN1CCN(CC1)C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1085699 |
