Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1C |
|---|---|
| DrugBank ID | DB09231 |
| Drug Name | Benidipine |
| Target ID | BE0008715 |
| UniProt ID | O00555 |
| Regulation Type | antagonist |
| PubMed IDs | 16565579 |
| Citations | Yao K, Nagashima K, Miki H: Pharmacological, pharmacokinetic, and clinical properties of benidipine hydrochloride, a novel, long-acting calcium channel blocker. J Pharmacol Sci. 2006 Apr;100(4):243-61. Epub 2006 Mar 25. |
| Groups | Experimental |
| Direct Classification | N-benzylpiperidines |
| SMILES | COC(=O)C1=C(C)NC(C)=C([C@@H]1C1=CC=CC(=C1)[N+]([O-])=O)C(=O)O[C@@H]1CCCN(CC2=CC=CC=C2)C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL2105555 |
