Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1C |
|---|---|
| DrugBank ID | DB04920 |
| Drug Name | Clevidipine |
| Target ID | BE0000430 |
| UniProt ID | Q13936 |
| Regulation Type | |
| PubMed IDs | 15492770 |
| Citations | Nordlander M, Sjoquist PO, Ericsson H, Ryden L: Pharmacodynamic, pharmacokinetic and clinical effects of clevidipine, an ultrashort-acting calcium antagonist for rapid blood pressure control. Cardiovasc Drug Rev. 2004 Fall;22(3):227-50. |
| Groups | Approved; Investigational |
| Direct Classification | Dihydropyridinecarboxylic acids and derivatives |
| SMILES | CCCC(=O)OCOC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC(Cl)=C1Cl)C(=O)OC |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1237132 |
