| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20056727 | HPV | ENSG00000144852.20 | protein_coding | NR1I2 | No | No | 8856 | O75469 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | NR1I2 |
|---|---|
| DrugBank ID | DB00682 |
| Drug Name | Warfarin |
| Target ID | BE0000956 |
| UniProt ID | O75469 |
| Regulation Type | |
| PubMed IDs | 20735727 |
| Citations | Rulcova A, Prokopova I, Krausova L, Bitman M, Vrzal R, Dvorak Z, Blahos J, Pavek P: Stereoselective interactions of warfarin enantiomers with the pregnane X nuclear receptor in gene regulation of major drug-metabolizing cytochrome P450 enzymes. J Thromb Haemost. 2010 Dec;8(12):2708-17. doi: 10.1111/j.1538-7836.2010.04036.x. |
| Groups | Approved |
| Direct Classification | 4-hydroxycoumarins |
| SMILES | CC(=O)CC(C1=CC=CC=C1)C1=C(O)C2=C(OC1=O)C=CC=C2 |
| Pathways | Warfarin Action Pathway |
| PharmGKB | PA451906 |
| ChEMBL | CHEMBL1464 |
