| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20056727 | HPV | ENSG00000144852.20 | protein_coding | NR1I2 | No | No | 8856 | O75469 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | NR1I2 |
|---|---|
| DrugBank ID | DB14649 |
| Drug Name | Dexamethasone acetate |
| Target ID | BE0000956 |
| UniProt ID | O75469 |
| Regulation Type | agonist |
| PubMed IDs | 16054614 |
| Citations | Kretschmer XC, Baldwin WS: CAR and PXR: xenosensors of endocrine disrupters? Chem Biol Interact. 2005 Aug 15;155(3):111-28. |
| Groups | Approved; Investigational; Vet_approved |
| Direct Classification | Gluco/mineralocorticoids, progestogins and derivatives |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)COC(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1530428 |