| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20056727 | HPV | ENSG00000144852.20 | protein_coding | NR1I2 | No | No | 8856 | O75469 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | NR1I2 |
|---|---|
| DrugBank ID | DB01115 |
| Drug Name | Nifedipine |
| Target ID | BE0000956 |
| UniProt ID | O75469 |
| Regulation Type | agonist |
| PubMed IDs | 21291553 |
| Citations | Krasowski MD, Ai N, Hagey LR, Kollitz EM, Kullman SW, Reschly EJ, Ekins S: The evolution of farnesoid X, vitamin D, and pregnane X receptors: insights from the green-spotted pufferfish (Tetraodon nigriviridis) and other non-mammalian species. BMC Biochem. 2011 Feb 3;12:5. doi: 10.1186/1471-2091-12-5. |
| Groups | Approved |
| Direct Classification | Dihydropyridinecarboxylic acids and derivatives |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC=C1[N+]([O-])=O)C(=O)OC |
| Pathways | Nifedipine Action Pathway |
| PharmGKB | PA450631 |
| ChEMBL | CHEMBL193 |
