| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20056727 | HPV | ENSG00000144852.20 | protein_coding | NR1I2 | No | No | 8856 | O75469 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | NR1I2 |
|---|---|
| DrugBank ID | DB05928 |
| Drug Name | Dovitinib |
| Target ID | BE0000956 |
| UniProt ID | O75469 |
| Regulation Type | suppressor |
| PubMed IDs | 25521244 |
| Citations | Weiss J, Theile D, Dvorak Z, Haefeli WE: Interaction potential of the multitargeted receptor tyrosine kinase inhibitor dovitinib with drug transporters and drug metabolising enzymes assessed in vitro. Pharmaceutics. 2014 Dec 16;6(4):632-50. doi: 10.3390/pharmaceutics6040632. |
| Groups | Investigational |
| Direct Classification | N-arylpiperazines |
| SMILES | CN1CCN(CC1)C1=CC=C2N=C(NC2=C1)C1=C(N)C2=C(NC1=O)C=CC=C2F |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL522892 |
