| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20056727 | HPV | ENSG00000144852.20 | protein_coding | NR1I2 | No | No | 8856 | O75469 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | NR1I2 |
|---|---|
| DrugBank ID | DB01708 |
| Drug Name | Prasterone |
| Target ID | BE0000956 |
| UniProt ID | O75469 |
| Regulation Type | activator |
| PubMed IDs | 17591676 |
| Citations | Kohalmy K, Tamasi V, Kobori L, Sarvary E, Pascussi JM, Porrogi P, Rozman D, Prough RA, Meyer UA, Monostory K: Dehydroepiandrosterone induces human CYP2B6 through the constitutive androstane receptor. Drug Metab Dispos. 2007 Sep;35(9):1495-501. Epub 2007 Jun 25. |
| Groups | Approved; Investigational; Nutraceutical |
| Direct Classification | Androgens and derivatives |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@]([H])(O)CC[C@]12C |
| Pathways | |
| PharmGKB | PA451993 |
| ChEMBL | CHEMBL90593 |