| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20056727 | HPV | ENSG00000144852.20 | protein_coding | NR1I2 | No | No | 8856 | O75469 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | NR1I2 |
|---|---|
| DrugBank ID | DB13953 |
| Drug Name | Estradiol benzoate |
| Target ID | BE0000956 |
| UniProt ID | O75469 |
| Regulation Type | |
| PubMed IDs | 17327420 |
| Citations | Xue Y, Moore LB, Orans J, Peng L, Bencharit S, Kliewer SA, Redinbo MR: Crystal structure of the pregnane X receptor-estradiol complex provides insights into endobiotic recognition. Mol Endocrinol. 2007 May;21(5):1028-38. Epub 2007 Feb 27. |
| Groups | Approved; Investigational; Vet_approved |
| Direct Classification | Estrane steroids |
| SMILES | [H][C@]1(O)CC[C@@]2([H])[C@]3([H])CCC4=CC(OC(=O)C5=CC=CC=C5)=CC=C4[C@@]3([H])CC[C@]12C |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL282575 |