| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10016573 | HBV | ENSG00000102468.11 | protein_coding | HTR2A | No | No | 3356 | P28223 |
| TVIS44041305 | HTLV-1 | ENSG00000102468.11 | protein_coding | HTR2A | No | No | 3356 | P28223 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HTR2A |
|---|---|
| DrugBank ID | DB09194 |
| Drug Name | Etoperidone |
| Target ID | BE0000451 |
| UniProt ID | P28223 |
| Regulation Type | antagonist |
| PubMed IDs | 7855217 |
| Citations | Cusack B, Nelson A, Richelson E: Binding of antidepressants to human brain receptors: focus on newer generation compounds. Psychopharmacology (Berl). 1994 May;114(4):559-65. |
| Groups | Withdrawn |
| Direct Classification | Phenylpiperazines |
| SMILES | CCN1C(=O)N(CCCN2CCN(CC2)C2=CC=CC(Cl)=C2)N=C1CC |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1743259 |
