| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44018958 | HTLV-1 | ENSG00000196639.7 | protein_coding | HRH1 | No | No | 3269 | P35367 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HRH1 |
|---|---|
| DrugBank ID | DB00245 |
| Drug Name | Benzatropine |
| Target ID | BE0000442 |
| UniProt ID | P35367 |
| Regulation Type | antagonist |
| PubMed IDs | 16460947 |
| Citations | Kulkarni SS, Kopajtic TA, Katz JL, Newman AH: Comparative structure-activity relationships of benztropine analogues at the dopamine transporter and histamine H(1) receptors. Bioorg Med Chem. 2006 Jun 1;14(11):3625-34. Epub 2006 Feb 3. |
| Groups | Approved |
| Direct Classification | Diphenylmethanes |
| SMILES | [H][C@]12CC[C@]([H])(C[C@@]([H])(C1)OC(C1=CC=CC=C1)C1=CC=CC=C1)N2C |
| Pathways | |
| PharmGKB | PA448591 |
| ChEMBL | CHEMBL1201203 |