| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44018958 | HTLV-1 | ENSG00000196639.7 | protein_coding | HRH1 | No | No | 3269 | P35367 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HRH1 |
|---|---|
| DrugBank ID | DB00543 |
| Drug Name | Amoxapine |
| Target ID | BE0000442 |
| UniProt ID | P35367 |
| Regulation Type | antagonist |
| PubMed IDs | 6086881 |
| Citations | Richelson E, Nelson A: Antagonism by antidepressants of neurotransmitter receptors of normal human brain in vitro. J Pharmacol Exp Ther. 1984 Jul;230(1):94-102. |
| Groups | Approved |
| Direct Classification | Dibenzoxazepines |
| SMILES | ClC1=CC2=C(OC3=CC=CC=C3N=C2N2CCNCC2)C=C1 |
| Pathways | |
| PharmGKB | PA448405 |
| ChEMBL | CHEMBL1113 |
